The Synthesis of 7-chloro-4-[[4-(diethylamino)-1-methylbutyl]amino]quinoline sulfate: A Look at 132-73-0
The creation of complex organic molecules for pharmaceutical use often involves intricate multi-step synthesis processes. Within this domain, 1,4-Pentanediamine, N4-(7-chloro-4-quinolinyl)-N1,N1-diethyl-, sulfate (CAS 132-73-0) emerges as a compound with a structure that hints at its utility in synthesizing molecules with quinoline-based frameworks. Specifically, understanding the synthesis of 7-chloro-4-[[4-(diethylamino)-1-methylbutyl]amino]quinoline sulfate is key to appreciating the value of this particular intermediate.
The chemical intermediate CAS 132-73-0, often appearing as a white powder, serves as a critical component in achieving the desired molecular architecture. The presence of the 7-chloro-4-quinolinyl group is a significant structural feature that links it to various pharmacologically active compounds. The precise methodologies employed in its synthesis, and the subsequent reactions it undergoes, are subjects of intense research and development in organic chemistry. NINGBO INNO PHARMCHEM CO.,LTD. is involved in the supply chain that supports these vital synthetic efforts.
The relevance of such chemical intermediates extends to their role in creating compounds that might be used in treating conditions such as malaria or other inflammatory diseases, given the structural similarities to known antimalarial drugs. Exploring the synthetic routes for obtaining the N4-(7-chloro-4-quinolinyl)-N1,N1-diethyl-1,4-pentanediamine sulfate is crucial for researchers aiming to optimize yields and purity. This pursuit of efficient synthesis underpins the broader goal of making advanced pharmaceuticals accessible.
For chemical manufacturers and pharmaceutical companies, having access to reliable information about the synthesis and sourcing of compounds like 1,4-Pentanediamine, N4-(7-chloro-4-quinolinyl)-N1,N1-diethyl-, sulfate is essential. NINGBO INNO PHARMCHEM CO.,LTD. is committed to providing high-quality intermediates that facilitate these critical synthesis pathways, supporting the ongoing innovation in pharmaceutical research and development.
Perspectives & Insights
Molecule Vision 7
"Exploring the synthetic routes for obtaining the N4-(7-chloro-4-quinolinyl)-N1,N1-diethyl-1,4-pentanediamine sulfate is crucial for researchers aiming to optimize yields and purity."
Alpha Origin 24
"This pursuit of efficient synthesis underpins the broader goal of making advanced pharmaceuticals accessible."
Future Analyst X
"For chemical manufacturers and pharmaceutical companies, having access to reliable information about the synthesis and sourcing of compounds like 1,4-Pentanediamine, N4-(7-chloro-4-quinolinyl)-N1,N1-diethyl-, sulfate is essential."